Products 54753-09-2
CAS 54753-09-2 appears in our catalog under these names: 2-Methylimidazo(2,1-a)phthalazin-6-amine, 98%, 2-Methyl-imidazo[2,1-a]phthalazin-6-ylamine, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
2-methylimidazo[2,1-a]phthalazin-6-amine (CAS 54753-09-2) is a chemical compound with the molecular formula C11H10N4 and a molecular weight of 198.22 g/mol. IUPAC name: 2-methylimidazo[2,1-a]phthalazin-6-amine. InChIKey: QOIJWQJIXFOXCA-UHFFFAOYSA-N.
| Molecular formula | C11H10N4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-methylimidazo[2,1-a]phthalazin-6-amine |
| InChIKey | QOIJWQJIXFOXCA-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=N1)C3=CC=CC=C3C(=N2)N |
Computed by PubChem (NCBI)