Products 355808-21-8
CAS 355808-21-8 is the registry number for Acetylvaline-15N. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
N-[(3S)-2-hydroxy-4-methylpent-1-en-3-yl]acetamide (CAS 355808-21-8) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 158.20 g/mol. IUPAC name: N-[(3S)-2-hydroxy-4-methylpent-1-en-3-yl]acetamide. InChIKey: LWLMDAHVAJIJAT-DMSOPOIOSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | N-[(3S)-2-hydroxy-4-methylpent-1-en-3-yl]acetamide |
| InChIKey | LWLMDAHVAJIJAT-DMSOPOIOSA-N |
| SMILES | CC(C)[C@@H](C(=C)O)[15NH]C(=O)C |
Computed by PubChem (NCBI)