CAS 356066-44-9 appears in our catalog under these names: 2-({2-(2-(2-{((tert-Butoxy)carbonyl)amino}ethoxy)ethoxy)ethyl}amino)acetic acid, 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5,14-diazahexadecan-16-oic acid, 95%, 95%, NHBoc-PEG2-NH-CH2COOH, 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5,14-diazahexadecan-16-oic acid 95%. Offered by: Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 250 mg, 100 mg, 50 mg, 25 mg.
2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylamino]acetic acid (CAS 356066-44-9) is a chemical compound with the molecular formula C13H26N2O6 and a molecular weight of 306.36 g/mol. IUPAC name: 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylamino]acetic acid. InChIKey: PARIBPNCVYWBOX-UHFFFAOYSA-N.
| Molecular formula | C13H26N2O6 |
|---|---|
| Molecular weight | 306.36 g/mol |
| IUPAC name | 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylamino]acetic acid |
| InChIKey | PARIBPNCVYWBOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNCC(=O)O |
Computed by PubChem (NCBI)