Products 42417-17-4

CAS 42417-17-4 is the registry number for (2S)-6-amino-2-{[(tert-butoxy)carbonyl]amino}hexanoic acid, acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Acetic acid;(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 42417-17-4) is a chemical compound with the molecular formula C13H26N2O6 and a molecular weight of 306.36 g/mol. IUPAC name: acetic acid;(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: FXFZSDQYCDFSHA-QRPNPIFTSA-N.

Identity
Molecular formulaC13H26N2O6
Molecular weight306.36 g/mol
IUPAC nameacetic acid;(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid
InChIKeyFXFZSDQYCDFSHA-QRPNPIFTSA-N
SMILESCC(=O)O.CC(C)(C)OC(=O)N[C@@H](CCCCN)C(=O)O

Computed by PubChem (NCBI)