CAS 35656-93-0 appears in our catalog under these names: Benzyl-d7 Bromide, Benzyl-d7 Bromide, 98 atom % D, min 98% Chemical Purity, Benzyl–d7 Bromide, BENZYL-D7 BROMIDE, 98 ATOM % D. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 5mg, 1g, 0,5g, 500mg, 5G.
1-[bromo(dideuterio)methyl]-2,3,4,5,6-pentadeuteriobenzene (CAS 35656-93-0) is a chemical compound with the molecular formula C7H7Br and a molecular weight of 178.08 g/mol. IUPAC name: 1-[bromo(dideuterio)methyl]-2,3,4,5,6-pentadeuteriobenzene. InChIKey: AGEZXYOZHKGVCM-XZJKGWKKSA-N.
| Molecular formula | C7H7Br |
|---|---|
| Molecular weight | 178.08 g/mol |
| IUPAC name | 1-[bromo(dideuterio)methyl]-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | AGEZXYOZHKGVCM-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])Br)[2H])[2H] |
Computed by PubChem (NCBI)