Products 71258-22-5
CAS 71258-22-5 appears in our catalog under these names: Benzyl-d5 Bromide, >95% (HPLC), Benzyl-2,3,4,5,6-d5 Bromide, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 250mg, 25mg, 1g.
1-(bromomethyl)-2,3,4,5,6-pentadeuteriobenzene (CAS 71258-22-5) is a chemical compound with the molecular formula C7H7Br and a molecular weight of 176.06 g/mol. IUPAC name: 1-(bromomethyl)-2,3,4,5,6-pentadeuteriobenzene. InChIKey: AGEZXYOZHKGVCM-RALIUCGRSA-N.
| Molecular formula | C7H7Br |
|---|---|
| Molecular weight | 176.06 g/mol |
| IUPAC name | 1-(bromomethyl)-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | AGEZXYOZHKGVCM-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CBr)[2H])[2H] |
Computed by PubChem (NCBI)