CAS 356786-94-2 appears in our catalog under these names: Vitamin B5-13C3,15N, Pantothenic Acid-13C3,15N Hemicalcium Salt, >95% (HPLC), VITAMIN B5 (DI-?-ALANINE-13C6,15N2) CALC, Pantothenic acid-13C3,15N (hemicalcium), Pantothenic acid-13C3,15N (hemicalcium), 99.3%. Offered by: Hubei YoungXin, TRC, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5MG, 1 mg.
Calcium bis(3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl](15N)amino](1,2,3-13C3)propanoate) (CAS 356786-94-2) is a chemical compound with the molecular formula C18H32CaN2O10 and a molecular weight of 484.47 g/mol. IUPAC name: calcium bis(3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl](15N)amino](1,2,3-13C3)propanoate). InChIKey: FAPWYRCQGJNNSJ-DXAJRXMUSA-L.
| Molecular formula | C18H32CaN2O10 |
|---|---|
| Molecular weight | 484.47 g/mol |
| IUPAC name | calcium bis(3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl](15N)amino](1,2,3-13C3)propanoate) |
| InChIKey | FAPWYRCQGJNNSJ-DXAJRXMUSA-L |
| SMILES | CC(C)(CO)[C@H](C(=O)[15NH][13CH2][13CH2][13C](=O)[O-])O.CC(C)(CO)[C@H](C(=O)[15NH][13CH2][13CH2][13C](=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)