CAS 63409-48-3 is the registry number for Calcium DL-pantothenate monohydrate. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g.
Calcium DL-pantothenate is an organonitrogen compound and an organooxygen compound. It is functionally related to a beta-amino acid.
Source: ChEBI
| Molecular formula | C18H32CaN2O10 |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | calcium bis(3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoate) |
| InChIKey | FAPWYRCQGJNNSJ-UHFFFAOYSA-L |
| SMILES | CC(C)(CO)C(C(=O)NCCC(=O)[O-])O.CC(C)(CO)C(C(=O)NCCC(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)