Products 356790-44-8
CAS 356790-44-8 is the registry number for (R)-(1-Benzylpyrrolidin-2-yl)diphenylmethanol 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(2R)-1-benzylpyrrolidin-2-yl]-diphenylmethanol (CAS 356790-44-8) is a chemical compound with the molecular formula C24H25NO and a molecular weight of 343.5 g/mol. IUPAC name: [(2R)-1-benzylpyrrolidin-2-yl]-diphenylmethanol. InChIKey: AZOXPIPWRDWNBA-HSZRJFAPSA-N.
| Molecular formula | C24H25NO |
|---|---|
| Molecular weight | 343.5 g/mol |
| IUPAC name | [(2R)-1-benzylpyrrolidin-2-yl]-diphenylmethanol |
| InChIKey | AZOXPIPWRDWNBA-HSZRJFAPSA-N |
| SMILES | C1C[C@@H](N(C1)CC2=CC=CC=C2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)