CAS 97151-10-5 is the registry number for 2-(4-((E)-1,2-Diphenyl-ethenyl)phenoxy)-N,N-dimethylethanamine. Offered by: Mikromol. Available pack sizes: 25mg.
2-[4-[(E)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine (CAS 97151-10-5) is a chemical compound with the molecular formula C24H25NO and a molecular weight of 343.5 g/mol. IUPAC name: 2-[4-[(E)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine. InChIKey: PXOWMFOUQCRAAG-LYBHJNIJSA-N.
| Molecular formula | C24H25NO |
|---|---|
| Molecular weight | 343.5 g/mol |
| IUPAC name | 2-[4-[(E)-1,2-diphenylethenyl]phenoxy]-N,N-dimethylethanamine |
| InChIKey | PXOWMFOUQCRAAG-LYBHJNIJSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)/C(=C/C2=CC=CC=C2)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)