CAS 35782-21-9 is the registry number for Fluorene-d8. Offered by: MedChemExpress. Available pack sizes: 500 mg, 10 g, 1 g, 100 mg, 5 g.
1,2,3,4,5,6,7,8-octadeuterio-9H-fluorene (CAS 35782-21-9) is a chemical compound with the molecular formula C13H10 and a molecular weight of 174.27 g/mol. IUPAC name: 1,2,3,4,5,6,7,8-octadeuterio-9H-fluorene. InChIKey: NIHNNTQXNPWCJQ-PGRXLJNUSA-N.
| Molecular formula | C13H10 |
|---|---|
| Molecular weight | 174.27 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8-octadeuterio-9H-fluorene |
| InChIKey | NIHNNTQXNPWCJQ-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])CC3=C(C(=C(C(=C32)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)