Products 35782-21-9

CAS 35782-21-9 is the registry number for Fluorene-d8. Offered by: MedChemExpress. Available pack sizes: 500 mg, 10 g, 1 g, 100 mg, 5 g.

Structural formula: {0} (CAS {1})

1,2,3,4,5,6,7,8-octadeuterio-9H-fluorene (CAS 35782-21-9) is a chemical compound with the molecular formula C13H10 and a molecular weight of 174.27 g/mol. IUPAC name: 1,2,3,4,5,6,7,8-octadeuterio-9H-fluorene. InChIKey: NIHNNTQXNPWCJQ-PGRXLJNUSA-N.

Identity
Molecular formulaC13H10
Molecular weight174.27 g/mol
IUPAC name1,2,3,4,5,6,7,8-octadeuterio-9H-fluorene
InChIKeyNIHNNTQXNPWCJQ-PGRXLJNUSA-N
SMILES[2H]C1=C(C(=C2C(=C1[2H])CC3=C(C(=C(C(=C32)[2H])[2H])[2H])[2H])[2H])[2H]

Computed by PubChem (NCBI)