Products 81103-79-9
CAS 81103-79-9 appears in our catalog under these names: Fluorene-D10, Fluorene D10, Fluorene D10 10 µg/mL in Cyclohexane, Fluorene-d10, 98 atom % D, min 98% Chemical Purity, Fluorene–d10. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 50mg, 10ml, 1g, 0,5g, 100 mg, 50 mg, 1x100mg.
1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene (CAS 81103-79-9) is a chemical compound with the molecular formula C13H10 and a molecular weight of 176.28 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene. InChIKey: NIHNNTQXNPWCJQ-QNNBDYQESA-N.
| Molecular formula | C13H10 |
|---|---|
| Molecular weight | 176.28 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene |
| InChIKey | NIHNNTQXNPWCJQ-QNNBDYQESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C(=C3C2([2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Fluorene-d10, 9H-Fluorene-1,2,3,4,5,6,7,8,9,9-d10, Deuterated fluorene, 9HFluorene1,2,3,4,5,6,7,8,9,9d10, 1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene, Fluorene D10, 9H-Fluorene-1,2,3,4,5,6,7,8,9,9-d10; Fluorene-d10; Perdeuterofluorene, (~2~H_10_)-9H-Fluorene, Fluorene D10 10 microg/mL in Cyclohexane, Fluorene-d10, 98 atom % D, 99% (CP)