CAS 35794-84-4 appears in our catalog under these names: 2-Acetyl-4-cyanophenol, 2-Acetyl-4-cyanophenol 98%, 2-Acetyl-4-cyanophenol, 98%, Benzonitrile, 3-acetyl-4-hydroxy-, 98%, 98%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
3-acetyl-4-hydroxybenzonitrile (CAS 35794-84-4) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 3-acetyl-4-hydroxybenzonitrile. InChIKey: HSZUUVJFZOGAMB-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-acetyl-4-hydroxybenzonitrile |
| InChIKey | HSZUUVJFZOGAMB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)C#N)O |
Computed by PubChem (NCBI)