Products 358380-49-1

CAS 358380-49-1 is the registry number for N-(2-Ethoxyphenyl)-n-(phenylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[N-(benzenesulfonyl)-2-ethoxyanilino]acetic acid (CAS 358380-49-1) is a chemical compound with the molecular formula C16H17NO5S and a molecular weight of 335.4 g/mol. IUPAC name: 2-[N-(benzenesulfonyl)-2-ethoxyanilino]acetic acid. InChIKey: YXFFRLRIPOLUSP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO5S
Molecular weight335.4 g/mol
IUPAC name2-[N-(benzenesulfonyl)-2-ethoxyanilino]acetic acid
InChIKeyYXFFRLRIPOLUSP-UHFFFAOYSA-N
SMILESCCOC1=CC=CC=C1N(CC(=O)O)S(=O)(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)