Products 748776-34-3
CAS 748776-34-3 appears in our catalog under these names: 3-(Benzyl(methyl)sulfamoyl)-4-methoxybenzoic acid, 95%, 3-(Benzyl-methyl-sulfamoyl)-4-methoxy-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
3-[benzyl(methyl)sulfamoyl]-4-methoxybenzoic acid (CAS 748776-34-3) is a chemical compound with the molecular formula C16H17NO5S and a molecular weight of 335.4 g/mol. IUPAC name: 3-[benzyl(methyl)sulfamoyl]-4-methoxybenzoic acid. InChIKey: XXWAFHJMVVRVLT-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 3-[benzyl(methyl)sulfamoyl]-4-methoxybenzoic acid |
| InChIKey | XXWAFHJMVVRVLT-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)S(=O)(=O)C2=C(C=CC(=C2)C(=O)O)OC |
Computed by PubChem (NCBI)