Products 35845-62-6
CAS 35845-62-6 appears in our catalog under these names: Hydrocinnamic-d5 Acid (phenyl-d5), Hydrocinnamic-d5 Acid (phenyl-d5), 98 atom % D, min 98% Chemical Purity, 3-phenylpropionic acid-d5, Hydrocinnamic acid–d5, Hydrocinnamic acid-d5, 99.71%. Offered by: TRC, CDN, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 250mg, 500mg, 0,5g, 0,25g, 1mg, 5mg, 10mg, 25mg.
3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 35845-62-6) is a chemical compound with the molecular formula C9H10O2 and a molecular weight of 155.20 g/mol. IUPAC name: 3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: XMIIGOLPHOKFCH-RALIUCGRSA-N.
| Molecular formula | C9H10O2 |
|---|---|
| Molecular weight | 155.20 g/mol |
| IUPAC name | 3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | XMIIGOLPHOKFCH-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)