Products 93131-15-8
CAS 93131-15-8 appears in our catalog under these names: Hydrocinnamic-d9 Acid, >95% (GC), Hydrocinnamic-d9 Acid, 99 atom % D, min 98% Chemical Purity, Hydrocinnamic acid–d9, Hydrocinnamic acid-d9, 99.65%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g, 25mg, 100 mg, 50 mg.
2,2,3,3-tetradeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 93131-15-8) is a chemical compound with the molecular formula C9H10O2 and a molecular weight of 159.23 g/mol. IUPAC name: 2,2,3,3-tetradeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: XMIIGOLPHOKFCH-NVLGFDPUSA-N.
| Molecular formula | C9H10O2 |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | 2,2,3,3-tetradeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | XMIIGOLPHOKFCH-NVLGFDPUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)