Products 3585-49-7
CAS 3585-49-7 appears in our catalog under these names: Ibuprofen EP Impurity B, p-Butyl Ibuprofen, >95% (HPLC), p-Butyl Ibuprofen (~90%), (2RS)-2-(4-Butylphenyl)propanoic Acid, 2-(4-Butylphenyl)propionic acid, racemic. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 1mg, 2mg, 100mg, 50mg, 25mg, 5000mg.
2-(4-butylphenyl)propanoic acid (CAS 3585-49-7) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 2-(4-butylphenyl)propanoic acid. InChIKey: FEFPDZIYEWFQFK-UHFFFAOYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 2-(4-butylphenyl)propanoic acid |
| InChIKey | FEFPDZIYEWFQFK-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)C(C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
p-Butylhydratropic Acid, Ibuprofen Impurity B, 2-(4-n-Butylphenyl)propionic Acid, 2-(p-Butylphenyl)propionic Acid, (2RS)-2-(4-Butylphenyl)propanoic acid, Ibuprofen impurity B [EP], 4-Butyl-alpha-methylbenzeneacetic acid, Benzeneacetic acid, 4-butyl-alpha-methyl-, IBUPROFEN IMPURITY B [EP IMPURITY], IBUPROFEN IMPURITY B (EP IMPURITY)