Products 3585-53-3

CAS 3585-53-3 appears in our catalog under these names: 2–(4–phenoxyphenyl)propanoic acid, 2-(4-phenoxyphenyl)propanoic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 5g, 100mg.

Structural formula: {0} (CAS {1})

2-(4-phenoxyphenyl)propanoic acid (CAS 3585-53-3) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(4-phenoxyphenyl)propanoic acid. InChIKey: CQWOKJLMSWMOCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O3
Molecular weight242.27 g/mol
IUPAC name2-(4-phenoxyphenyl)propanoic acid
InChIKeyCQWOKJLMSWMOCJ-UHFFFAOYSA-N
SMILESCC(C1=CC=C(C=C1)OC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)