CAS 3597-42-0 appears in our catalog under these names: 6-Methoxy-1-naphthaldehyde, 98%, 6-Methoxy-1-naphthaldehyde, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
6-methoxynaphthalene-1-carbaldehyde (CAS 3597-42-0) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 6-methoxynaphthalene-1-carbaldehyde. InChIKey: RQSRLHYBIGCTIS-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 6-methoxynaphthalene-1-carbaldehyde |
| InChIKey | RQSRLHYBIGCTIS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC=C2)C=O |
Computed by PubChem (NCBI)