CAS 35986-02-8 appears in our catalog under these names: (1R,3R,5R,7R)-6-Tosyl-2-oxa-6-azaadamantane, 95%, (1r,3r,5r,7r)–6–tosyl–2–oxa–6–azaadamantane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
6-(4-methylphenyl)sulfonyl-2-oxa-6-azatricyclo[3.3.1.13,7]decane (CAS 35986-02-8) is a chemical compound with the molecular formula C15H19NO3S and a molecular weight of 293.4 g/mol. IUPAC name: 6-(4-methylphenyl)sulfonyl-2-oxa-6-azatricyclo[3.3.1.13,7]decane. InChIKey: DMHPIBKXATYXKC-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3S |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 6-(4-methylphenyl)sulfonyl-2-oxa-6-azatricyclo[3.3.1.13,7]decane |
| InChIKey | DMHPIBKXATYXKC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3CC4CC2CC(C3)O4 |
Computed by PubChem (NCBI)