CAS 59229-09-3 appears in our catalog under these names: 2,4,6–Trimethylpyridinium p–toluenesulfonate 98%, 2,4,6-Trimethylpyridinium p-Toluenesulfonate, >98.0%(T), 2,4,6-Trimethylpyridinium p-Toluenesulfonate, 98%, 98%, TMPTS, 98%. Offered by: GLPBio, TCI, Chemat, Ambeed. Available pack sizes: 100g, 25g, 5g, 10g, 50g, 500g.
4-methylbenzenesulfonate;2,4,6-trimethylpyridin-1-ium (CAS 59229-09-3) is a chemical compound with the molecular formula C15H19NO3S and a molecular weight of 293.4 g/mol. IUPAC name: 4-methylbenzenesulfonate;2,4,6-trimethylpyridin-1-ium. InChIKey: VEXWNPGPVMYVDU-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3S |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;2,4,6-trimethylpyridin-1-ium |
| InChIKey | VEXWNPGPVMYVDU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].CC1=CC(=[NH+]C(=C1)C)C |
Computed by PubChem (NCBI)