Products 360574-94-3

CAS 360574-94-3 is the registry number for 2-(Hydroxydiphenylmethyl)-1-pyrrolidinecarboxylic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[hydroxy(diphenyl)methyl]pyrrolidine-1-carboxylate (CAS 360574-94-3) is a chemical compound with the molecular formula C22H27NO3 and a molecular weight of 353.5 g/mol. IUPAC name: tert-butyl 2-[hydroxy(diphenyl)methyl]pyrrolidine-1-carboxylate. InChIKey: IRUWVJPUDXOJLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H27NO3
Molecular weight353.5 g/mol
IUPAC nametert-butyl 2-[hydroxy(diphenyl)methyl]pyrrolidine-1-carboxylate
InChIKeyIRUWVJPUDXOJLJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC1C(C2=CC=CC=C2)(C3=CC=CC=C3)O

Computed by PubChem (NCBI)