Products 95240-93-0
CAS 95240-93-0 is the registry number for L 44-0. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2-tert-butyl-4-cyclohexylphenyl) 1-oxidopyridin-1-ium-3-carboxylate (CAS 95240-93-0) is a chemical compound with the molecular formula C22H27NO3 and a molecular weight of 353.5 g/mol. IUPAC name: (2-tert-butyl-4-cyclohexylphenyl) 1-oxidopyridin-1-ium-3-carboxylate. InChIKey: PKTVPGYSIOIYJT-UHFFFAOYSA-N.
| Molecular formula | C22H27NO3 |
|---|---|
| Molecular weight | 353.5 g/mol |
| IUPAC name | (2-tert-butyl-4-cyclohexylphenyl) 1-oxidopyridin-1-ium-3-carboxylate |
| InChIKey | PKTVPGYSIOIYJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)C2CCCCC2)OC(=O)C3=C[N+](=CC=C3)[O-] |
Computed by PubChem (NCBI)