Products 36159-73-6
CAS 36159-73-6 is the registry number for 4-(4-Chlorophenyl)-3,4-dihydro-1(2H)-naphthalenone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
4-(4-chlorophenyl)-3,4-dihydro-2H-naphthalen-1-one (CAS 36159-73-6) is a chemical compound with the molecular formula C16H13ClO and a molecular weight of 256.72 g/mol. IUPAC name: 4-(4-chlorophenyl)-3,4-dihydro-2H-naphthalen-1-one. InChIKey: VLJJFAJBTHYFKK-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO |
|---|---|
| Molecular weight | 256.72 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | VLJJFAJBTHYFKK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC=CC=C2C1C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)