CAS 37620-37-4 is the registry number for 3-(4-Chlorophenyl)-1-(p-tolyl)prop-2-en-1-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3-(4-chlorophenyl)-1-(4-methylphenyl)prop-2-en-1-one (CAS 37620-37-4) is a chemical compound with the molecular formula C16H13ClO and a molecular weight of 256.72 g/mol. IUPAC name: 3-(4-chlorophenyl)-1-(4-methylphenyl)prop-2-en-1-one. InChIKey: WSEZVGWJTWBTQK-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO |
|---|---|
| Molecular weight | 256.72 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1-(4-methylphenyl)prop-2-en-1-one |
| InChIKey | WSEZVGWJTWBTQK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C=CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)