Products 36192-16-2
CAS 36192-16-2 is the registry number for Methanimidamide, N,N-dimethyl-N'-(2-methyl-5-nitrophenyl)-, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N,N-dimethyl-N'-(2-methyl-5-nitrophenyl)methanimidamide (CAS 36192-16-2) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: N,N-dimethyl-N'-(2-methyl-5-nitrophenyl)methanimidamide. InChIKey: GCXGIXLKKZHERT-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | N,N-dimethyl-N'-(2-methyl-5-nitrophenyl)methanimidamide |
| InChIKey | GCXGIXLKKZHERT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])N=CN(C)C |
Computed by PubChem (NCBI)