Products 362049-51-2
CAS 362049-51-2 appears in our catalog under these names: Methyl 4-hydroxybenzoate-2,3,5,6-d4, 95%, Methyl Paraben-D4, Methyl Paraben-d4, >95% (HPLC), Methyl 4-Hydroxybenzoate-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, D4-Methylparaben, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Combi-blocks, Chemat Brand, TRC, CDN, Biosynth. Available pack sizes: 100mg, 1g, 250mg, on request, 2,5mg, 25mg, 0,1g, 0,05g.
Methyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate (CAS 362049-51-2) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 156.17 g/mol. IUPAC name: methyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate. InChIKey: LXCFILQKKLGQFO-QFFDRWTDSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 156.17 g/mol |
| IUPAC name | methyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate |
| InChIKey | LXCFILQKKLGQFO-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OC)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)