Products 362525-67-5

CAS 362525-67-5 is the registry number for Tegoprazan Impurity 19. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

6-bromo-2,3-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridine (CAS 362525-67-5) is a chemical compound with the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. IUPAC name: 6-bromo-2,3-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridine. InChIKey: CVQJKRFLJGJENU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15BrN2O
Molecular weight331.21 g/mol
IUPAC name6-bromo-2,3-dimethyl-8-phenylmethoxyimidazo[1,2-a]pyridine
InChIKeyCVQJKRFLJGJENU-UHFFFAOYSA-N
SMILESCC1=C(N2C=C(C=C(C2=N1)OCC3=CC=CC=C3)Br)C

Computed by PubChem (NCBI)