Products 844900-78-3
CAS 844900-78-3 is the registry number for 5-Bromo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)nicotinamide. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-3-carboxamide (CAS 844900-78-3) is a chemical compound with the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. IUPAC name: 5-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-3-carboxamide. InChIKey: ZPXACHIUXSNLMG-UHFFFAOYSA-N.
| Molecular formula | C16H15BrN2O |
|---|---|
| Molecular weight | 331.21 g/mol |
| IUPAC name | 5-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pyridine-3-carboxamide |
| InChIKey | ZPXACHIUXSNLMG-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)NC(=O)C3=CC(=CN=C3)Br |
Computed by PubChem (NCBI)