CAS 362530-16-3 appears in our catalog under these names: 2-(3-bromophenyl)-4-methylpentanoic acid, 2-(3-Bromophenyl)-4-methylpentanoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 1g.
2-(3-bromophenyl)-4-methylpentanoic acid (CAS 362530-16-3) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: 2-(3-bromophenyl)-4-methylpentanoic acid. InChIKey: RTNLSQASZHIGDN-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | 2-(3-bromophenyl)-4-methylpentanoic acid |
| InChIKey | RTNLSQASZHIGDN-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)