CAS 36254-39-4 appears in our catalog under these names: 1-(4-Acetylphenyl)pyrrolidine-2,5-dione, 1-(4-Acetylphenyl)pyrrolidine-2,5-dione, 90%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
1-(4-acetylphenyl)pyrrolidine-2,5-dione (CAS 36254-39-4) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 1-(4-acetylphenyl)pyrrolidine-2,5-dione. InChIKey: OEMDVKXAOKHWHP-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 1-(4-acetylphenyl)pyrrolidine-2,5-dione |
| InChIKey | OEMDVKXAOKHWHP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2C(=O)CCC2=O |
Computed by PubChem (NCBI)