CAS 362594-28-3 is the registry number for 2-Chloro-N-(2-(trifluoromethyl)-1H-1,3-benzodiazol-5-yl)acetamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-chloro-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide (CAS 362594-28-3) is a chemical compound with the molecular formula C10H7ClF3N3O and a molecular weight of 277.63 g/mol. IUPAC name: 2-chloro-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide. InChIKey: JAAQGVSKJAZHKT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClF3N3O |
|---|---|
| Molecular weight | 277.63 g/mol |
| IUPAC name | 2-chloro-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide |
| InChIKey | JAAQGVSKJAZHKT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=O)CCl)NC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)