CAS 362612-68-8 appears in our catalog under these names: 4-Phenylthiophene-2-boronic acid, 97%, (4-Phenylthiophen-2-yl)boronic acid, 98+%, 4–Phenylthiophene–2–boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
(4-phenylthiophen-2-yl)boronic acid (CAS 362612-68-8) is a chemical compound with the molecular formula C10H9BO2S and a molecular weight of 204.06 g/mol. IUPAC name: (4-phenylthiophen-2-yl)boronic acid. InChIKey: SSHJHAPMTBLTLN-UHFFFAOYSA-N.
| Molecular formula | C10H9BO2S |
|---|---|
| Molecular weight | 204.06 g/mol |
| IUPAC name | (4-phenylthiophen-2-yl)boronic acid |
| InChIKey | SSHJHAPMTBLTLN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CS1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)