CAS 475206-83-8 appears in our catalog under these names: 3-(3-Thienyl)phenylboronic acid, 95%, (3-(Thiophen-3-yl)phenyl)boronic acid 95%, 3-(3-Thienyl)phenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
(3-thiophen-3-ylphenyl)boronic acid (CAS 475206-83-8) is a chemical compound with the molecular formula C10H9BO2S and a molecular weight of 204.06 g/mol. IUPAC name: (3-thiophen-3-ylphenyl)boronic acid. InChIKey: ZDQQNWSDOWJSGZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BO2S |
|---|---|
| Molecular weight | 204.06 g/mol |
| IUPAC name | (3-thiophen-3-ylphenyl)boronic acid |
| InChIKey | ZDQQNWSDOWJSGZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CSC=C2)(O)O |
Computed by PubChem (NCBI)