CAS 362670-09-5 appears in our catalog under these names: N1–Boc–5–methoxy–1,2–benzenediamine, N1-Boc-5-methoxy-1,2-benzenediamine, 96%, N1-Boc-5-methoxy-1,2-benzenediamine, 98%, 98%, tert-Butyl (2-amino-5-methoxyphenyl)carbamate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Tert-butyl N-(2-amino-5-methoxyphenyl)carbamate (CAS 362670-09-5) is a chemical compound with the molecular formula C12H18N2O3 and a molecular weight of 238.28 g/mol. IUPAC name: tert-butyl N-(2-amino-5-methoxyphenyl)carbamate. InChIKey: ATQQUUXZLWAIMY-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | tert-butyl N-(2-amino-5-methoxyphenyl)carbamate |
| InChIKey | ATQQUUXZLWAIMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)OC)N |
Computed by PubChem (NCBI)