CAS 36305-05-2 appears in our catalog under these names: 4–Diazo–3–methoxydiphenylamine Sulfate, 4-Diazo-3-methoxydiphenylamine Sulfate. Offered by: GLPBio, Chemat. Available pack sizes: 5g.
4-anilino-2-methoxybenzenediazonium;hydrogen sulfate (CAS 36305-05-2) is a chemical compound with the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. IUPAC name: 4-anilino-2-methoxybenzenediazonium;hydrogen sulfate. InChIKey: HBDLDBQEQKQUPI-UHFFFAOYSA-M.
| Molecular formula | C13H13N3O5S |
|---|---|
| Molecular weight | 323.33 g/mol |
| IUPAC name | 4-anilino-2-methoxybenzenediazonium;hydrogen sulfate |
| InChIKey | HBDLDBQEQKQUPI-UHFFFAOYSA-M |
| SMILES | COC1=C(C=CC(=C1)NC2=CC=CC=C2)[N+]#N.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)