CAS 49732-38-9 appears in our catalog under these names: 4-Diazo-4'-methoxydiphenylamine Sulfate, >98.0%(HPLC)(T), 4-Diazo-4'-methoxydiphenylamine Sulfate, 98%, 98%. Offered by: TCI, Chemat. Available pack sizes: 25g, 5g.
Hydrogen sulfate;4-(4-methoxyanilino)benzenediazonium (CAS 49732-38-9) is a chemical compound with the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. IUPAC name: hydrogen sulfate;4-(4-methoxyanilino)benzenediazonium. InChIKey: UXVMTJSLLAUFTO-UHFFFAOYSA-M.
| Molecular formula | C13H13N3O5S |
|---|---|
| Molecular weight | 323.33 g/mol |
| IUPAC name | hydrogen sulfate;4-(4-methoxyanilino)benzenediazonium |
| InChIKey | UXVMTJSLLAUFTO-UHFFFAOYSA-M |
| SMILES | COC1=CC=C(C=C1)NC2=CC=C(C=C2)[N+]#N.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)