Products 36305-63-2
CAS 36305-63-2 is the registry number for 2,3-Bis(4-methoxyphenyl)-6-methylquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2,3-bis(4-methoxyphenyl)-6-methylquinoxaline (CAS 36305-63-2) is a chemical compound with the molecular formula C23H20N2O2 and a molecular weight of 356.4 g/mol. IUPAC name: 2,3-bis(4-methoxyphenyl)-6-methylquinoxaline. InChIKey: ZUPKXQAWVWGXPI-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O2 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2,3-bis(4-methoxyphenyl)-6-methylquinoxaline |
| InChIKey | ZUPKXQAWVWGXPI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C(=N2)C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)