Products 536758-07-3
CAS 536758-07-3 is the registry number for tert-Butyl indolo[3,2-b]carbazole-5(11H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 11H-indolo[3,2-b]carbazole-5-carboxylate (CAS 536758-07-3) is a chemical compound with the molecular formula C23H20N2O2 and a molecular weight of 356.4 g/mol. IUPAC name: tert-butyl 11H-indolo[3,2-b]carbazole-5-carboxylate. InChIKey: AZQUSXQSPRZCQD-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O2 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | tert-butyl 11H-indolo[3,2-b]carbazole-5-carboxylate |
| InChIKey | AZQUSXQSPRZCQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2C3=CC4=C(C=C31)C5=CC=CC=C5N4 |
Computed by PubChem (NCBI)