CAS 363135-56-2 appears in our catalog under these names: 5,7-Dimethoxyquinoline-3-carbaldehyde, 95%, 5,7-dimethoxyquinoline-3-carbaldehyde, 5,7-Dimethoxyquinoline-3-carbaldehyde, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 25mg.
5,7-dimethoxyquinoline-3-carbaldehyde (CAS 363135-56-2) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 5,7-dimethoxyquinoline-3-carbaldehyde. InChIKey: REMMPEQBRHIIEE-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 5,7-dimethoxyquinoline-3-carbaldehyde |
| InChIKey | REMMPEQBRHIIEE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C(C=N2)C=O)C(=C1)OC |
Computed by PubChem (NCBI)