CAS 36323-03-2 appears in our catalog under these names: 15(S)–acetate Prostaglandin A2 methyl ester, 15(S)-Acetate prostaglandin A2 methyl ester. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10 mg, 1 mg.
Methyl (Z)-7-[(1R,2S)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate (CAS 36323-03-2) is a chemical compound with the molecular formula C23H34O5 and a molecular weight of 390.5 g/mol. IUPAC name: methyl (Z)-7-[(1R,2S)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate. InChIKey: KURMKPDMINCWHJ-RXMNKVFOSA-N.
| Molecular formula | C23H34O5 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | methyl (Z)-7-[(1R,2S)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
| InChIKey | KURMKPDMINCWHJ-RXMNKVFOSA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)