CAS 364-13-6 appears in our catalog under these names: 2,5-Diaminobenzotrifluoride, 98%, 2–(Trifluoromethyl)–1,4–phenylenediamine, 2-(Trifluoromethyl)-1,4-phenylenediamine, >98.0%(GC)(T), 1,4-Benzenediamine, 2-(trifluoromethyl)-, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100g.
2-(trifluoromethyl)benzene-1,4-diamine (CAS 364-13-6) is a chemical compound with the molecular formula C7H7F3N2 and a molecular weight of 176.14 g/mol. IUPAC name: 2-(trifluoromethyl)benzene-1,4-diamine. InChIKey: ZQQOGBKIFPCFMJ-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2 |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | ZQQOGBKIFPCFMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)N |
Computed by PubChem (NCBI)