CAS 36452-33-2 is the registry number for 2,2'-Dihydroxy-3,3',5,5'-tetrabromodiphenyl ether. Offered by: TRC. Available pack sizes: 50mg.
2,4-dibromo-6-(3,5-dibromo-2-hydroxyphenoxy)phenol (CAS 36452-33-2) is a chemical compound with the molecular formula C12H6Br4O3 and a molecular weight of 517.79 g/mol. IUPAC name: 2,4-dibromo-6-(3,5-dibromo-2-hydroxyphenoxy)phenol. InChIKey: KIHDTBLTKPAXNV-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O3 |
|---|---|
| Molecular weight | 517.79 g/mol |
| IUPAC name | 2,4-dibromo-6-(3,5-dibromo-2-hydroxyphenoxy)phenol |
| InChIKey | KIHDTBLTKPAXNV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC2=C(C(=CC(=C2)Br)Br)O)O)Br)Br |
Computed by PubChem (NCBI)