CAS 897014-99-2 is the registry number for 2,4-Dibromo-6-(3,5-dibromo-4-hydroxyphenoxy)phenol. Offered by: TRC. Available pack sizes: 100mg.
2,6-dibromo-4-(3,5-dibromo-2-hydroxyphenoxy)phenol (CAS 897014-99-2) is a chemical compound with the molecular formula C12H6Br4O3 and a molecular weight of 517.79 g/mol. IUPAC name: 2,6-dibromo-4-(3,5-dibromo-2-hydroxyphenoxy)phenol. InChIKey: QWAHJFBSOMURAX-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O3 |
|---|---|
| Molecular weight | 517.79 g/mol |
| IUPAC name | 2,6-dibromo-4-(3,5-dibromo-2-hydroxyphenoxy)phenol |
| InChIKey | QWAHJFBSOMURAX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)OC2=C(C(=CC(=C2)Br)Br)O |
Computed by PubChem (NCBI)