Products 364744-54-7

CAS 364744-54-7 is the registry number for Methyl 5-((2-bromophenoxy)methyl)-2-furoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 5-[(2-bromophenoxy)methyl]furan-2-carboxylate (CAS 364744-54-7) is a chemical compound with the molecular formula C13H11BrO4 and a molecular weight of 311.13 g/mol. IUPAC name: methyl 5-[(2-bromophenoxy)methyl]furan-2-carboxylate. InChIKey: GTYZBMRBFGOSBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BrO4
Molecular weight311.13 g/mol
IUPAC namemethyl 5-[(2-bromophenoxy)methyl]furan-2-carboxylate
InChIKeyGTYZBMRBFGOSBJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(O1)COC2=CC=CC=C2Br

Computed by PubChem (NCBI)