CAS 402771-33-9 is the registry number for Methyl 5-((4-bromophenoxy)methyl)-2-furoate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Methyl 5-[(4-bromophenoxy)methyl]furan-2-carboxylate (CAS 402771-33-9) is a chemical compound with the molecular formula C13H11BrO4 and a molecular weight of 311.13 g/mol. IUPAC name: methyl 5-[(4-bromophenoxy)methyl]furan-2-carboxylate. InChIKey: QCQFRSSEHASBBM-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO4 |
|---|---|
| Molecular weight | 311.13 g/mol |
| IUPAC name | methyl 5-[(4-bromophenoxy)methyl]furan-2-carboxylate |
| InChIKey | QCQFRSSEHASBBM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(O1)COC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)