CAS 36476-14-9 is the registry number for 2,4-Dichloro-6,7,8-trimethoxyquinazoline, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2,4-dichloro-6,7,8-trimethoxyquinazoline (CAS 36476-14-9) is a chemical compound with the molecular formula C11H10Cl2N2O3 and a molecular weight of 289.11 g/mol. IUPAC name: 2,4-dichloro-6,7,8-trimethoxyquinazoline. InChIKey: HWWHFNPXISVYOL-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2O3 |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | 2,4-dichloro-6,7,8-trimethoxyquinazoline |
| InChIKey | HWWHFNPXISVYOL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C(=NC(=N2)Cl)Cl)OC)OC |
Computed by PubChem (NCBI)