CAS 61948-64-9 is the registry number for 2,4-Dichloro-5,6,7-trimethoxyquinazoline, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-dichloro-5,6,7-trimethoxyquinazoline (CAS 61948-64-9) is a chemical compound with the molecular formula C11H10Cl2N2O3 and a molecular weight of 289.11 g/mol. IUPAC name: 2,4-dichloro-5,6,7-trimethoxyquinazoline. InChIKey: CMCKRAIOYZMRSJ-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2O3 |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | 2,4-dichloro-5,6,7-trimethoxyquinazoline |
| InChIKey | CMCKRAIOYZMRSJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)N=C(N=C2Cl)Cl)OC)OC |
Computed by PubChem (NCBI)