CAS 36476-87-6 appears in our catalog under these names: 1-Benzhydrylazetidine-3-carboxylic Acid, 1–Benzhydrylazetidine–3–carboxylic Acid, 1-Benzhydrylazetane-3-carboxylic acid, 95% , 1-Benzhydrylazetidine-3-carboxylic Acid, >98.0%(HPLC)(T), 1-(Diphenylmethyl)azetidine-3-carboxylic Acid 98%. Offered by: TRC, GLPBio, Thermo Scientific, TCI, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 100g, 25g, 5g.
1-benzhydrylazetidine-3-carboxylic acid (CAS 36476-87-6) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: 1-benzhydrylazetidine-3-carboxylic acid. InChIKey: BRSCYENHLCPOAU-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 1-benzhydrylazetidine-3-carboxylic acid |
| InChIKey | BRSCYENHLCPOAU-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)